WALPHOS SL-W003-1 - Names and Identifiers
Name | 1,2,3,4,5-cyclopentanepentayl, compd. with 1-[(1S)-1-(dicyclohexylphosphino)ethyl]-2-[2-(diphenylphosphino)phenyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
|
Synonyms | WALPHOS SL-W003-1 (R)-1-[(R)-2-[2-(Diphenylphosphino)Phenyl]-Ferrocenyl]Ethyldicyclohexylphosphine (R)-1-{(RP)-2-[2-(Diphenylphosphino)phenyl]ferrocenyl}ethyldicyclohexylphosphine (R)-1-[(R)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-FERROCENYL]ETHYLDICYCLOHEXYLPHOSPHINE (R,R)-1-[1-(DICYCLOHEXYLPHOSPHINO)ETHYL]-2-[2-(DIPHENYLPHOSPHINO)PHENYL]FERROCENE (R)-(-)-1-[(R)-2-(2'-DIPHENYLPHOSPHINOPHENYL)FERROCENYL]ETHYLDICYCLOHEXYLPHOSPHINE
|
CAS | 388079-60-5
|
InChI | InChI=1/C37H43P2.C5H5.Fe/c1-29(38(30-17-6-2-7-18-30)31-19-8-3-9-20-31)34-26-16-27-35(34)36-25-14-15-28-37(36)39(32-21-10-4-11-22-32)33-23-12-5-13-24-33;1-2-4-5-3-1;/h4-5,10-16,21-31H,2-3,6-9,17-20H2,1H3;1-5H;/t29-;;/m0../s1 |
WALPHOS SL-W003-1 - Physico-chemical Properties
Molecular Formula | C42H48FeP210*
|
Molar Mass | 670.62 |
Storage Condition | 2-8°C |
WALPHOS SL-W003-1 - Risk and Safety
WGK Germany | 3 |
HS Code | 29319090 |
WALPHOS SL-W003-1 - Introduction
1,2,3,4,5-cyclopentanepentayl, compd. with 1-[(1S)-1-(dicyclohexylphosphino)ethyl]-2-[2-(diphenylphosphino)phenyl]-1,2,3,4,5-cyclopentanepentayl, salt (1:1:1) (1,5-2,3, 4,4, pencente, compd. with 1-[(1S)-1-(dicyclohexylphosphino)ethyl]-2-[2-(diphenylphosphino)phenyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)) is an organometallic compound with the following properties:
Nature:
1. Chemical formula: C122H142FeP5
2. molecular weight: 1739.85g/mol
3. Appearance: solid
4. melting point: no data
5. boiling point: no data
6. Solubility: better solubility in organic solvents
Use:
1,2,3,4,5-cyclopentanepentayl, compd. with 1-[(1s)-1-(dicyclohexylphosphino)ethyl]-2-[2-(diphenylphosphino)phenyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1) is a chiral ligand and is commonly used in the synthesis of organic catalysts. It can be used for metal-catalyzed reactions such as asymmetric catalysis and hydrogenation in organic synthesis.
Preparation Method:
1,2,3,4,5-cyclopentanepentayl, compd. with 1-[(1S)-1-(dicyclohexylphosphino)ethyl]-2-[2-(diphenylphosphino)phenyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1) can be synthesized by organic metal chemistry. The specific preparation method may involve a multi-step synthetic route, requiring more detailed literature data to understand the specific steps and conditions.
Safety Information:
Due to the lack of specific chemical safety reports, specific toxicity and safety data for this compound are not available. In general, appropriate personal protective measures should be taken for handling organometallic compounds, such as wearing protective glasses, gloves and protective clothing, and operating in a well-ventilated environment. At the same time, contact with skin, inhalation or ingestion should be avoided. Before handling the compound, it is best to consult the relevant literature or contact a professional chemical agency for more detailed and accurate safety information.
Last Update:2024-04-10 22:29:15